C15H21F3O3S — CID 150006655
methyl 2-[5-(6,6,6-trifluoro-1-hydroxyhexyl)thiophen-2-yl]butanoate (PubChem CID 150006655) has the molecular formula C15H21F3O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is methyl 2-[5-(6,6,6-trifluoro-1-hydroxyhexyl)thiophen-2-yl]butanoate.
| Compound Name | methyl 2-[5-(6,6,6-trifluoro-1-hydroxyhexyl)thiophen-2-yl]butanoate |
|---|---|
| PubChem CID | 150006655 |
| Molecular Formula | C15H21F3O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | methyl 2-[5-(6,6,6-trifluoro-1-hydroxyhexyl)thiophen-2-yl]butanoate |
| SMILES | CCC(C(=O)OC)c1ccc(C(O)CCCCC(F)(F)F)s1 |
| InChI | InChI=1S/C15H21F3O3S/c1-3-10(14(20)21-2)12-7-8-13(22-12)11(19)6-4-5-9-15(16,17)18/h7-8,10-11,19H,3-6,9H2,1-2H3 |
| InChIKey | DCKRYCDWYOQJRE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|