C16H25NS2 — CID 115835455
N-methyl-1-thieno[3,2-b]thiophen-5-ylnonan-1-amine (PubChem CID 115835455) has the molecular formula C16H25NS2 and a molecular weight of 295.52 g/mol. Its IUPAC name is N-methyl-1-thieno[3,2-b]thiophen-5-ylnonan-1-amine.
| Compound Name | N-methyl-1-thieno[3,2-b]thiophen-5-ylnonan-1-amine |
|---|---|
| PubChem CID | 115835455 |
| Molecular Formula | C16H25NS2 |
| Molecular Weight | 295.52 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-methyl-1-thieno[3,2-b]thiophen-5-ylnonan-1-amine |
| SMILES | CCCCCCCCC(NC)c1cc2sccc2s1 |
| InChI | InChI=1S/C16H25NS2/c1-3-4-5-6-7-8-9-13(17-2)15-12-16-14(19-15)10-11-18-16/h10-13,17H,3-9H2,1-2H3 |
| InChIKey | PQCHZBYKKPPFAY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.52 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|