C17H19NS2 — CID 115849469
N-methyl-4-phenyl-1-thieno[3,2-b]thiophen-5-ylbutan-1-amine (PubChem CID 115849469) has the molecular formula C17H19NS2 and a molecular weight of 301.48 g/mol. Its IUPAC name is N-methyl-4-phenyl-1-thieno[3,2-b]thiophen-5-ylbutan-1-amine.
| Compound Name | N-methyl-4-phenyl-1-thieno[3,2-b]thiophen-5-ylbutan-1-amine |
|---|---|
| PubChem CID | 115849469 |
| Molecular Formula | C17H19NS2 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-methyl-4-phenyl-1-thieno[3,2-b]thiophen-5-ylbutan-1-amine |
| SMILES | CNC(CCCc1ccccc1)c1cc2sccc2s1 |
| InChI | InChI=1S/C17H19NS2/c1-18-14(9-5-8-13-6-3-2-4-7-13)16-12-17-15(20-16)10-11-19-17/h2-4,6-7,10-12,14,18H,5,8-9H2,1H3 |
| InChIKey | RYIGSUDVFYISJO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |