C16H27Br2NS — CID 115845955
1-(4,5-dibromothiophen-2-yl)-N-methylundecan-1-amine (PubChem CID 115845955) has the molecular formula C16H27Br2NS and a molecular weight of 425.27 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-N-methylundecan-1-amine.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-N-methylundecan-1-amine |
|---|---|
| PubChem CID | 115845955 |
| Molecular Formula | C16H27Br2NS |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-N-methylundecan-1-amine |
| SMILES | CCCCCCCCCCC(NC)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C16H27Br2NS/c1-3-4-5-6-7-8-9-10-11-14(19-2)15-12-13(17)16(18)20-15/h12,14,19H,3-11H2,1-2H3 |
| InChIKey | FOVABIQSZLGQGC-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|