C12H18Br2OS — CID 80535373
1-(4,5-dibromothiophen-2-yl)octan-1-ol (PubChem CID 80535373) has the molecular formula C12H18Br2OS and a molecular weight of 370.15 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)octan-1-ol.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)octan-1-ol |
|---|---|
| PubChem CID | 80535373 |
| Molecular Formula | C12H18Br2OS |
| Molecular Weight | 370.15 g/mol |
| Exact Mass | 367.94 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)octan-1-ol |
| SMILES | CCCCCCCC(O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H18Br2OS/c1-2-3-4-5-6-7-10(15)11-8-9(13)12(14)16-11/h8,10,15H,2-7H2,1H3 |
| InChIKey | RCUHXALQAOVPPU-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.15 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|