C9H12Br2O2S — CID 115839601
1-(4,5-dibromothiophen-2-yl)-4-methoxybutan-1-ol (PubChem CID 115839601) has the molecular formula C9H12Br2O2S and a molecular weight of 344.07 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-4-methoxybutan-1-ol.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 115839601 |
| Molecular Formula | C9H12Br2O2S |
| Molecular Weight | 344.07 g/mol |
| Exact Mass | 341.89 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-4-methoxybutan-1-ol |
| SMILES | COCCCC(O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C9H12Br2O2S/c1-13-4-2-3-7(12)8-5-6(10)9(11)14-8/h5,7,12H,2-4H2,1H3 |
| InChIKey | LDBOOFQVZZCLQH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.07 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|