About thieno[2,3-c]thiophene
thieno[2,3-c]thiophene (PubChem CID 520171) has the molecular formula C6H4S2
and a molecular weight of 140.23 g/mol. Its IUPAC name is thieno[2,3-c]thiophene.
Molecular Properties
| Compound Name | thieno[2,3-c]thiophene |
| PubChem CID | 520171 |
| Molecular Formula | C6H4S2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 139.98 |
| IUPAC Name | thieno[2,3-c]thiophene |
| SMILES | c1cc2cscc2s1 |
| InChI | InChI=1S/C6H4S2/c1-2-8-6-4-7-3-5(1)6/h1-4H |
| InChIKey | PFZLGKHSYILJTH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze thieno[2,3-c]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[2,3-c]thiophene?
The IUPAC name of thieno[2,3-c]thiophene (CID 520171) is thieno[2,3-c]thiophene.
What is the SMILES notation for thieno[2,3-c]thiophene?
The canonical SMILES for thieno[2,3-c]thiophene is c1cc2cscc2s1.
What is the InChIKey of thieno[2,3-c]thiophene?
The InChIKey is PFZLGKHSYILJTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4S2/c1-2-8-6-4-7-3-5(1)6/h1-4H.
What are the key properties of thieno[2,3-c]thiophene?
thieno[2,3-c]thiophene has a molecular weight of 140.23 g/mol, XLogP of 2.96, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[2,3-c]thiophene is sourced from PubChem (CID 520171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).