C10H14N2S — CID 168913952
ethane;2-methylthieno[2,3-b]pyridin-5-amine (PubChem CID 168913952) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is ethane;2-methylthieno[2,3-b]pyridin-5-amine.
| Compound Name | ethane;2-methylthieno[2,3-b]pyridin-5-amine |
|---|---|
| PubChem CID | 168913952 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | ethane;2-methylthieno[2,3-b]pyridin-5-amine |
| SMILES | CC.Cc1cc2cc(N)cnc2s1 |
| InChI | InChI=1S/C8H8N2S.C2H6/c1-5-2-6-3-7(9)4-10-8(6)11-5;1-2/h2-4H,9H2,1H3;1-2H3 |
| InChIKey | UXLJKXCDIZZJKL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |