About ethane;molecular hydrogen;quinolin-3-amine
ethane;molecular hydrogen;quinolin-3-amine (PubChem CID 145187853) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is ethane;molecular hydrogen;quinolin-3-amine.
Molecular Properties
| Compound Name | ethane;molecular hydrogen;quinolin-3-amine |
| PubChem CID | 145187853 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | ethane;molecular hydrogen;quinolin-3-amine |
| SMILES | CC.Nc1cnc2ccccc2c1.[H][H] |
| InChI | InChI=1S/C9H8N2.C2H6.H2/c10-8-5-7-3-1-2-4-9(7)11-6-8;1-2;/h1-6H,10H2;1-2H3;1H |
| InChIKey | DZUMTCXFGQGGFO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;molecular hydrogen;quinolin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;molecular hydrogen;quinolin-3-amine?
The IUPAC name of ethane;molecular hydrogen;quinolin-3-amine (CID 145187853) is ethane;molecular hydrogen;quinolin-3-amine.
What is the SMILES notation for ethane;molecular hydrogen;quinolin-3-amine?
The canonical SMILES for ethane;molecular hydrogen;quinolin-3-amine is CC.Nc1cnc2ccccc2c1.[H][H].
What is the InChIKey of ethane;molecular hydrogen;quinolin-3-amine?
The InChIKey is DZUMTCXFGQGGFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.C2H6.H2/c10-8-5-7-3-1-2-4-9(7)11-6-8;1-2;/h1-6H,10H2;1-2H3;1H.
What are the key properties of ethane;molecular hydrogen;quinolin-3-amine?
ethane;molecular hydrogen;quinolin-3-amine has a molecular weight of 176.26 g/mol, XLogP of 3.09, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;molecular hydrogen;quinolin-3-amine is sourced from PubChem (CID 145187853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).