About quinoline-3-sulfinamide
quinoline-3-sulfinamide (PubChem CID 167254753) has the molecular formula C9H8N2OS
and a molecular weight of 192.24 g/mol. Its IUPAC name is quinoline-3-sulfinamide.
Molecular Properties
| Compound Name | quinoline-3-sulfinamide |
| PubChem CID | 167254753 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | quinoline-3-sulfinamide |
| SMILES | NS(=O)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C9H8N2OS/c10-13(12)8-5-7-3-1-2-4-9(7)11-6-8/h1-6H,10H2 |
| InChIKey | PEPSQTCOHXEDTI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze quinoline-3-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline-3-sulfinamide?
The IUPAC name of quinoline-3-sulfinamide (CID 167254753) is quinoline-3-sulfinamide.
What is the SMILES notation for quinoline-3-sulfinamide?
The canonical SMILES for quinoline-3-sulfinamide is NS(=O)c1cnc2ccccc2c1.
What is the InChIKey of quinoline-3-sulfinamide?
The InChIKey is PEPSQTCOHXEDTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2OS/c10-13(12)8-5-7-3-1-2-4-9(7)11-6-8/h1-6H,10H2.
What are the key properties of quinoline-3-sulfinamide?
quinoline-3-sulfinamide has a molecular weight of 192.24 g/mol, XLogP of 1.22, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline-3-sulfinamide is sourced from PubChem (CID 167254753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).