About quinoline-3-carboxamide;hydrofluoride
quinoline-3-carboxamide;hydrofluoride (PubChem CID 174911514) has the molecular formula C10H9FN2O
and a molecular weight of 192.19 g/mol. Its IUPAC name is quinoline-3-carboxamide;hydrofluoride.
Molecular Properties
| Compound Name | quinoline-3-carboxamide;hydrofluoride |
| PubChem CID | 174911514 |
| Molecular Formula | C10H9FN2O |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | quinoline-3-carboxamide;hydrofluoride |
| SMILES | F.NC(=O)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C10H8N2O.FH/c11-10(13)8-5-7-3-1-2-4-9(7)12-6-8;/h1-6H,(H2,11,13);1H |
| InChIKey | NPZRVFPQHKRVRE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze quinoline-3-carboxamide;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline-3-carboxamide;hydrofluoride?
The IUPAC name of quinoline-3-carboxamide;hydrofluoride (CID 174911514) is quinoline-3-carboxamide;hydrofluoride.
What is the SMILES notation for quinoline-3-carboxamide;hydrofluoride?
The canonical SMILES for quinoline-3-carboxamide;hydrofluoride is F.NC(=O)c1cnc2ccccc2c1.
What is the InChIKey of quinoline-3-carboxamide;hydrofluoride?
The InChIKey is NPZRVFPQHKRVRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O.FH/c11-10(13)8-5-7-3-1-2-4-9(7)12-6-8;/h1-6H,(H2,11,13);1H.
What are the key properties of quinoline-3-carboxamide;hydrofluoride?
quinoline-3-carboxamide;hydrofluoride has a molecular weight of 192.19 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline-3-carboxamide;hydrofluoride is sourced from PubChem (CID 174911514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).