carbonyl dichloride;quinoline-3-carboxylic acid

C11H7Cl2NO3 — CID 175289113

IUPACcarbonyl dichloride;quinoline-3-carboxylic acid
SMILESO=C(Cl)Cl.O=C(O)c1cnc2ccccc2c1
InChIInChI=1S/C10H7NO2.CCl2O/c12-10(13)8-5-7-3-1-2-4-9(7)11-6-8;2-1(3)4/h1-6H,(H,12,13);
InChIKeyGZTYFDBWRFQUNY-UHFFFAOYSA-N
MW272.09 g/mol
LogP3.52
Rot. Bonds1

About carbonyl dichloride;quinoline-3-carboxylic acid

carbonyl dichloride;quinoline-3-carboxylic acid (PubChem CID 175289113) has the molecular formula C11H7Cl2NO3 and a molecular weight of 272.09 g/mol. Its IUPAC name is carbonyl dichloride;quinoline-3-carboxylic acid.

Molecular Properties

Compound Namecarbonyl dichloride;quinoline-3-carboxylic acid
PubChem CID175289113
Molecular FormulaC11H7Cl2NO3
Molecular Weight272.09 g/mol
Exact Mass270.98
IUPAC Namecarbonyl dichloride;quinoline-3-carboxylic acid
SMILESO=C(Cl)Cl.O=C(O)c1cnc2ccccc2c1
InChIInChI=1S/C10H7NO2.CCl2O/c12-10(13)8-5-7-3-1-2-4-9(7)11-6-8;2-1(3)4/h1-6H,(H,12,13);
InChIKeyGZTYFDBWRFQUNY-UHFFFAOYSA-N
XLogP3.52
TPSA67.26 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.09
LogP ≤ 53.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze carbonyl dichloride;quinoline-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbonyl dichloride;quinoline-3-carboxylic acid?
The IUPAC name of carbonyl dichloride;quinoline-3-carboxylic acid (CID 175289113) is carbonyl dichloride;quinoline-3-carboxylic acid.
What is the SMILES notation for carbonyl dichloride;quinoline-3-carboxylic acid?
The canonical SMILES for carbonyl dichloride;quinoline-3-carboxylic acid is O=C(Cl)Cl.O=C(O)c1cnc2ccccc2c1.
What is the InChIKey of carbonyl dichloride;quinoline-3-carboxylic acid?
The InChIKey is GZTYFDBWRFQUNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2.CCl2O/c12-10(13)8-5-7-3-1-2-4-9(7)11-6-8;2-1(3)4/h1-6H,(H,12,13);.
What are the key properties of carbonyl dichloride;quinoline-3-carboxylic acid?
carbonyl dichloride;quinoline-3-carboxylic acid has a molecular weight of 272.09 g/mol, XLogP of 3.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonyl dichloride;quinoline-3-carboxylic acid is sourced from PubChem (CID 175289113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).