About carbonyl dichloride;quinoline-3-carboxylic acid
carbonyl dichloride;quinoline-3-carboxylic acid (PubChem CID 175289113) has the molecular formula C11H7Cl2NO3
and a molecular weight of 272.09 g/mol. Its IUPAC name is carbonyl dichloride;quinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | carbonyl dichloride;quinoline-3-carboxylic acid |
| PubChem CID | 175289113 |
| Molecular Formula | C11H7Cl2NO3 |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | carbonyl dichloride;quinoline-3-carboxylic acid |
| SMILES | O=C(Cl)Cl.O=C(O)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C10H7NO2.CCl2O/c12-10(13)8-5-7-3-1-2-4-9(7)11-6-8;2-1(3)4/h1-6H,(H,12,13); |
| InChIKey | GZTYFDBWRFQUNY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze carbonyl dichloride;quinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonyl dichloride;quinoline-3-carboxylic acid?
The IUPAC name of carbonyl dichloride;quinoline-3-carboxylic acid (CID 175289113) is carbonyl dichloride;quinoline-3-carboxylic acid.
What is the SMILES notation for carbonyl dichloride;quinoline-3-carboxylic acid?
The canonical SMILES for carbonyl dichloride;quinoline-3-carboxylic acid is O=C(Cl)Cl.O=C(O)c1cnc2ccccc2c1.
What is the InChIKey of carbonyl dichloride;quinoline-3-carboxylic acid?
The InChIKey is GZTYFDBWRFQUNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2.CCl2O/c12-10(13)8-5-7-3-1-2-4-9(7)11-6-8;2-1(3)4/h1-6H,(H,12,13);.
What are the key properties of carbonyl dichloride;quinoline-3-carboxylic acid?
carbonyl dichloride;quinoline-3-carboxylic acid has a molecular weight of 272.09 g/mol, XLogP of 3.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonyl dichloride;quinoline-3-carboxylic acid is sourced from PubChem (CID 175289113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).