About N-tert-butyl-N-methylpentan-1-amine;quinoline-3-carboxylic acid
N-tert-butyl-N-methylpentan-1-amine;quinoline-3-carboxylic acid (PubChem CID 174934752) has the molecular formula C20H30N2O2
and a molecular weight of 330.47 g/mol. Its IUPAC name is N-tert-butyl-N-methylpentan-1-amine;quinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | N-tert-butyl-N-methylpentan-1-amine;quinoline-3-carboxylic acid |
| PubChem CID | 174934752 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | N-tert-butyl-N-methylpentan-1-amine;quinoline-3-carboxylic acid |
| SMILES | CCCCCN(C)C(C)(C)C.O=C(O)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C10H7NO2.C10H23N/c12-10(13)8-5-7-3-1-2-4-9(7)11-6-8;1-6-7-8-9-11(5)10(2,3)4/h1-6H,(H,12,13);6-9H2,1-5H3 |
| InChIKey | KCJAKHPQFFMXIY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N-methylpentan-1-amine;quinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N-methylpentan-1-amine;quinoline-3-carboxylic acid?
The IUPAC name of N-tert-butyl-N-methylpentan-1-amine;quinoline-3-carboxylic acid (CID 174934752) is N-tert-butyl-N-methylpentan-1-amine;quinoline-3-carboxylic acid.
What is the SMILES notation for N-tert-butyl-N-methylpentan-1-amine;quinoline-3-carboxylic acid?
The canonical SMILES for N-tert-butyl-N-methylpentan-1-amine;quinoline-3-carboxylic acid is CCCCCN(C)C(C)(C)C.O=C(O)c1cnc2ccccc2c1.
What is the InChIKey of N-tert-butyl-N-methylpentan-1-amine;quinoline-3-carboxylic acid?
The InChIKey is KCJAKHPQFFMXIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2.C10H23N/c12-10(13)8-5-7-3-1-2-4-9(7)11-6-8;1-6-7-8-9-11(5)10(2,3)4/h1-6H,(H,12,13);6-9H2,1-5H3.
What are the key properties of N-tert-butyl-N-methylpentan-1-amine;quinoline-3-carboxylic acid?
N-tert-butyl-N-methylpentan-1-amine;quinoline-3-carboxylic acid has a molecular weight of 330.47 g/mol, XLogP of 4.84, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N-methylpentan-1-amine;quinoline-3-carboxylic acid is sourced from PubChem (CID 174934752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).