About [3-(dimethylamino)propylamino] quinoline-3-carboxylate
[3-(dimethylamino)propylamino] quinoline-3-carboxylate (PubChem CID 140615069) has the molecular formula C15H19N3O2
and a molecular weight of 273.34 g/mol. Its IUPAC name is [3-(dimethylamino)propylamino] quinoline-3-carboxylate.
Molecular Properties
| Compound Name | [3-(dimethylamino)propylamino] quinoline-3-carboxylate |
| PubChem CID | 140615069 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | [3-(dimethylamino)propylamino] quinoline-3-carboxylate |
| SMILES | CN(C)CCCNOC(=O)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C15H19N3O2/c1-18(2)9-5-8-17-20-15(19)13-10-12-6-3-4-7-14(12)16-11-13/h3-4,6-7,10-11,17H,5,8-9H2,1-2H3 |
| InChIKey | PMIZKRQEOAFVFW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(dimethylamino)propylamino] quinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(dimethylamino)propylamino] quinoline-3-carboxylate?
The IUPAC name of [3-(dimethylamino)propylamino] quinoline-3-carboxylate (CID 140615069) is [3-(dimethylamino)propylamino] quinoline-3-carboxylate.
What is the SMILES notation for [3-(dimethylamino)propylamino] quinoline-3-carboxylate?
The canonical SMILES for [3-(dimethylamino)propylamino] quinoline-3-carboxylate is CN(C)CCCNOC(=O)c1cnc2ccccc2c1.
What is the InChIKey of [3-(dimethylamino)propylamino] quinoline-3-carboxylate?
The InChIKey is PMIZKRQEOAFVFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O2/c1-18(2)9-5-8-17-20-15(19)13-10-12-6-3-4-7-14(12)16-11-13/h3-4,6-7,10-11,17H,5,8-9H2,1-2H3.
What are the key properties of [3-(dimethylamino)propylamino] quinoline-3-carboxylate?
[3-(dimethylamino)propylamino] quinoline-3-carboxylate has a molecular weight of 273.34 g/mol, XLogP of 1.85, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(dimethylamino)propylamino] quinoline-3-carboxylate is sourced from PubChem (CID 140615069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).