C13H22N2S — CID 155686385
ethane;2,4,6-trimethylthieno[2,3-d]pyrimidine (PubChem CID 155686385) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is ethane;2,4,6-trimethylthieno[2,3-d]pyrimidine.
| Compound Name | ethane;2,4,6-trimethylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 155686385 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | ethane;2,4,6-trimethylthieno[2,3-d]pyrimidine |
| SMILES | CC.CC.Cc1nc(C)c2cc(C)sc2n1 |
| InChI | InChI=1S/C9H10N2S.2C2H6/c1-5-4-8-6(2)10-7(3)11-9(8)12-5;2*1-2/h4H,1-3H3;2*1-2H3 |
| InChIKey | CPALERXLRUJXBA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |