C10H13N3OS2 — CID 82146504
2-(3-aminopropylsulfanyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 82146504) has the molecular formula C10H13N3OS2 and a molecular weight of 255.37 g/mol. Its IUPAC name is 2-(3-aminopropylsulfanyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(3-aminopropylsulfanyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 82146504 |
| Molecular Formula | C10H13N3OS2 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 2-(3-aminopropylsulfanyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1cc2c(=O)[nH]c(SCCCN)nc2s1 |
| InChI | InChI=1S/C10H13N3OS2/c1-6-5-7-8(14)12-10(13-9(7)16-6)15-4-2-3-11/h5H,2-4,11H2,1H3,(H,12,13,14) |
| InChIKey | HWKFDQNGYUSZPM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|