About 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine
2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine (PubChem CID 117275717) has the molecular formula C7H7N3S2
and a molecular weight of 197.29 g/mol. Its IUPAC name is 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine.
Analyze 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine?
The IUPAC name of 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine (CID 117275717) is 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine.
What is the SMILES notation for 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine?
The canonical SMILES for 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine is CSc1nc2ncc(N)cc2s1.
What is the InChIKey of 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine?
The InChIKey is LBTVRRMLFSTEFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3S2/c1-11-7-10-6-5(12-7)2-4(8)3-9-6/h2-3H,8H2,1H3.
What are the key properties of 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine?
2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine has a molecular weight of 197.29 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine is sourced from PubChem (CID 117275717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).