About methyl 6-amino-[1,3]thiazolo[4,5-b]pyridine-2-carboxylate
methyl 6-amino-[1,3]thiazolo[4,5-b]pyridine-2-carboxylate (PubChem CID 76850392) has the molecular formula C8H7N3O2S
and a molecular weight of 209.23 g/mol. Its IUPAC name is methyl 6-amino-[1,3]thiazolo[4,5-b]pyridine-2-carboxylate.
Analyze methyl 6-amino-[1,3]thiazolo[4,5-b]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-amino-[1,3]thiazolo[4,5-b]pyridine-2-carboxylate?
The IUPAC name of methyl 6-amino-[1,3]thiazolo[4,5-b]pyridine-2-carboxylate (CID 76850392) is methyl 6-amino-[1,3]thiazolo[4,5-b]pyridine-2-carboxylate.
What is the SMILES notation for methyl 6-amino-[1,3]thiazolo[4,5-b]pyridine-2-carboxylate?
The canonical SMILES for methyl 6-amino-[1,3]thiazolo[4,5-b]pyridine-2-carboxylate is COC(=O)c1nc2ncc(N)cc2s1.
What is the InChIKey of methyl 6-amino-[1,3]thiazolo[4,5-b]pyridine-2-carboxylate?
The InChIKey is CXMNNDDQVNEMOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2S/c1-13-8(12)7-11-6-5(14-7)2-4(9)3-10-6/h2-3H,9H2,1H3.
What are the key properties of methyl 6-amino-[1,3]thiazolo[4,5-b]pyridine-2-carboxylate?
methyl 6-amino-[1,3]thiazolo[4,5-b]pyridine-2-carboxylate has a molecular weight of 209.23 g/mol, XLogP of 1.06, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-amino-[1,3]thiazolo[4,5-b]pyridine-2-carboxylate is sourced from PubChem (CID 76850392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).