C8H5FN2O2S — CID 76850391
methyl 5-fluoro-[1,3]thiazolo[4,5-b]pyridine-2-carboxylate (PubChem CID 76850391) has the molecular formula C8H5FN2O2S and a molecular weight of 212.20 g/mol. Its IUPAC name is methyl 5-fluoro-[1,3]thiazolo[4,5-b]pyridine-2-carboxylate.
| Compound Name | methyl 5-fluoro-[1,3]thiazolo[4,5-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 76850391 |
| Molecular Formula | C8H5FN2O2S |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | methyl 5-fluoro-[1,3]thiazolo[4,5-b]pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc2nc(F)ccc2s1 |
| InChI | InChI=1S/C8H5FN2O2S/c1-13-8(12)7-11-6-4(14-7)2-3-5(9)10-6/h2-3H,1H3 |
| InChIKey | MBADKTVBPWAMEE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|