C8H5ClN2O2S — CID 130055645
methyl 5-chloro-[1,3]thiazolo[5,4-b]pyridine-2-carboxylate (PubChem CID 130055645) has the molecular formula C8H5ClN2O2S and a molecular weight of 228.66 g/mol. Its IUPAC name is methyl 5-chloro-[1,3]thiazolo[5,4-b]pyridine-2-carboxylate.
| Compound Name | methyl 5-chloro-[1,3]thiazolo[5,4-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 130055645 |
| Molecular Formula | C8H5ClN2O2S |
| Molecular Weight | 228.66 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | methyl 5-chloro-[1,3]thiazolo[5,4-b]pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc2ccc(Cl)nc2s1 |
| InChI | InChI=1S/C8H5ClN2O2S/c1-13-8(12)7-10-4-2-3-5(9)11-6(4)14-7/h2-3H,1H3 |
| InChIKey | KCTKQZFZFZGWRU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.66 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|