About methyl 5-[(2-amino-[1,3]thiazolo[5,4-b]pyridin-5-yl)-methylamino]-2-chlorobenzoate
methyl 5-[(2-amino-[1,3]thiazolo[5,4-b]pyridin-5-yl)-methylamino]-2-chlorobenzoate (PubChem CID 87816801) has the molecular formula C15H13ClN4O2S
and a molecular weight of 348.82 g/mol. Its IUPAC name is methyl 5-[(2-amino-[1,3]thiazolo[5,4-b]pyridin-5-yl)-methylamino]-2-chlorobenzoate.
Molecular Properties
| Compound Name | methyl 5-[(2-amino-[1,3]thiazolo[5,4-b]pyridin-5-yl)-methylamino]-2-chlorobenzoate |
| PubChem CID | 87816801 |
| Molecular Formula | C15H13ClN4O2S |
| Molecular Weight | 348.82 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | methyl 5-[(2-amino-[1,3]thiazolo[5,4-b]pyridin-5-yl)-methylamino]-2-chlorobenzoate |
| SMILES | COC(=O)c1cc(N(C)c2ccc3nc(N)sc3n2)ccc1Cl |
| InChI | InChI=1S/C15H13ClN4O2S/c1-20(8-3-4-10(16)9(7-8)14(21)22-2)12-6-5-11-13(19-12)23-15(17)18-11/h3-7H,1-2H3,(H2,17,18) |
| InChIKey | TWZQIVLZYVQAPC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.82 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 5-[(2-amino-[1,3]thiazolo[5,4-b]pyridin-5-yl)-methylamino]-2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(2-amino-[1,3]thiazolo[5,4-b]pyridin-5-yl)-methylamino]-2-chlorobenzoate?
The IUPAC name of methyl 5-[(2-amino-[1,3]thiazolo[5,4-b]pyridin-5-yl)-methylamino]-2-chlorobenzoate (CID 87816801) is methyl 5-[(2-amino-[1,3]thiazolo[5,4-b]pyridin-5-yl)-methylamino]-2-chlorobenzoate.
What is the SMILES notation for methyl 5-[(2-amino-[1,3]thiazolo[5,4-b]pyridin-5-yl)-methylamino]-2-chlorobenzoate?
The canonical SMILES for methyl 5-[(2-amino-[1,3]thiazolo[5,4-b]pyridin-5-yl)-methylamino]-2-chlorobenzoate is COC(=O)c1cc(N(C)c2ccc3nc(N)sc3n2)ccc1Cl.
What is the InChIKey of methyl 5-[(2-amino-[1,3]thiazolo[5,4-b]pyridin-5-yl)-methylamino]-2-chlorobenzoate?
The InChIKey is TWZQIVLZYVQAPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClN4O2S/c1-20(8-3-4-10(16)9(7-8)14(21)22-2)12-6-5-11-13(19-12)23-15(17)18-11/h3-7H,1-2H3,(H2,17,18).
What are the key properties of methyl 5-[(2-amino-[1,3]thiazolo[5,4-b]pyridin-5-yl)-methylamino]-2-chlorobenzoate?
methyl 5-[(2-amino-[1,3]thiazolo[5,4-b]pyridin-5-yl)-methylamino]-2-chlorobenzoate has a molecular weight of 348.82 g/mol, XLogP of 3.48, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(2-amino-[1,3]thiazolo[5,4-b]pyridin-5-yl)-methylamino]-2-chlorobenzoate is sourced from PubChem (CID 87816801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).