About 6-N-(5-chloro-3-pyridinyl)-6-N-methyl-1,3-benzothiazole-2,6-diamine
6-N-(5-chloro-3-pyridinyl)-6-N-methyl-1,3-benzothiazole-2,6-diamine (PubChem CID 156811688) has the molecular formula C13H11ClN4S
and a molecular weight of 290.78 g/mol. Its IUPAC name is 6-N-(5-chloro-3-pyridinyl)-6-N-methyl-1,3-benzothiazole-2,6-diamine.
Molecular Properties
| Compound Name | 6-N-(5-chloro-3-pyridinyl)-6-N-methyl-1,3-benzothiazole-2,6-diamine |
| PubChem CID | 156811688 |
| Molecular Formula | C13H11ClN4S |
| Molecular Weight | 290.78 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 6-N-(5-chloro-3-pyridinyl)-6-N-methyl-1,3-benzothiazole-2,6-diamine |
| SMILES | CN(c1cncc(Cl)c1)c1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C13H11ClN4S/c1-18(10-4-8(14)6-16-7-10)9-2-3-11-12(5-9)19-13(15)17-11/h2-7H,1H3,(H2,15,17) |
| InChIKey | XJWHTLNSEUYEMU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.78 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-N-(5-chloro-3-pyridinyl)-6-N-methyl-1,3-benzothiazole-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-(5-chloro-3-pyridinyl)-6-N-methyl-1,3-benzothiazole-2,6-diamine?
The IUPAC name of 6-N-(5-chloro-3-pyridinyl)-6-N-methyl-1,3-benzothiazole-2,6-diamine (CID 156811688) is 6-N-(5-chloro-3-pyridinyl)-6-N-methyl-1,3-benzothiazole-2,6-diamine.
What is the SMILES notation for 6-N-(5-chloro-3-pyridinyl)-6-N-methyl-1,3-benzothiazole-2,6-diamine?
The canonical SMILES for 6-N-(5-chloro-3-pyridinyl)-6-N-methyl-1,3-benzothiazole-2,6-diamine is CN(c1cncc(Cl)c1)c1ccc2nc(N)sc2c1.
What is the InChIKey of 6-N-(5-chloro-3-pyridinyl)-6-N-methyl-1,3-benzothiazole-2,6-diamine?
The InChIKey is XJWHTLNSEUYEMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClN4S/c1-18(10-4-8(14)6-16-7-10)9-2-3-11-12(5-9)19-13(15)17-11/h2-7H,1H3,(H2,15,17).
What are the key properties of 6-N-(5-chloro-3-pyridinyl)-6-N-methyl-1,3-benzothiazole-2,6-diamine?
6-N-(5-chloro-3-pyridinyl)-6-N-methyl-1,3-benzothiazole-2,6-diamine has a molecular weight of 290.78 g/mol, XLogP of 3.69, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-(5-chloro-3-pyridinyl)-6-N-methyl-1,3-benzothiazole-2,6-diamine is sourced from PubChem (CID 156811688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).