C9H9N3O2S — CID 84725218
methyl 2,6-diamino-1,3-benzothiazole-5-carboxylate (PubChem CID 84725218) has the molecular formula C9H9N3O2S and a molecular weight of 223.26 g/mol. Its IUPAC name is methyl 2,6-diamino-1,3-benzothiazole-5-carboxylate.
| Compound Name | methyl 2,6-diamino-1,3-benzothiazole-5-carboxylate |
|---|---|
| PubChem CID | 84725218 |
| Molecular Formula | C9H9N3O2S |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | methyl 2,6-diamino-1,3-benzothiazole-5-carboxylate |
| SMILES | COC(=O)c1cc2nc(N)sc2cc1N |
| InChI | InChI=1S/C9H9N3O2S/c1-14-8(13)4-2-6-7(3-5(4)10)15-9(11)12-6/h2-3H,10H2,1H3,(H2,11,12) |
| InChIKey | ZGCLVXLFZCQFAY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|