C7H6N2O2S — CID 13158929
2-amino-1,3-benzothiazole-5,6-diol (PubChem CID 13158929) has the molecular formula C7H6N2O2S and a molecular weight of 182.20 g/mol. Its IUPAC name is 2-amino-1,3-benzothiazole-5,6-diol.
| Compound Name | 2-amino-1,3-benzothiazole-5,6-diol |
|---|---|
| PubChem CID | 13158929 |
| Molecular Formula | C7H6N2O2S |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | 2-amino-1,3-benzothiazole-5,6-diol |
| SMILES | Nc1nc2cc(O)c(O)cc2s1 |
| InChI | InChI=1S/C7H6N2O2S/c8-7-9-3-1-4(10)5(11)2-6(3)12-7/h1-2,10-11H,(H2,8,9) |
| InChIKey | GJQLLPGZBJKRIG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|