C9H9ClN2S — CID 170435006
6-chloro-5-ethyl-1,3-benzothiazol-2-amine (PubChem CID 170435006) has the molecular formula C9H9ClN2S and a molecular weight of 212.71 g/mol. Its IUPAC name is 6-chloro-5-ethyl-1,3-benzothiazol-2-amine.
| Compound Name | 6-chloro-5-ethyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 170435006 |
| Molecular Formula | C9H9ClN2S |
| Molecular Weight | 212.71 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 6-chloro-5-ethyl-1,3-benzothiazol-2-amine |
| SMILES | CCc1cc2nc(N)sc2cc1Cl |
| InChI | InChI=1S/C9H9ClN2S/c1-2-5-3-7-8(4-6(5)10)13-9(11)12-7/h3-4H,2H2,1H3,(H2,11,12) |
| InChIKey | DZHTTXFCUPZWBC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.71 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |