C8H7ClN2OS — CID 138714330
2-amino-6-chloro-5-methyl-1,3-benzothiazol-4-ol (PubChem CID 138714330) has the molecular formula C8H7ClN2OS and a molecular weight of 214.68 g/mol. Its IUPAC name is 2-amino-6-chloro-5-methyl-1,3-benzothiazol-4-ol.
| Compound Name | 2-amino-6-chloro-5-methyl-1,3-benzothiazol-4-ol |
|---|---|
| PubChem CID | 138714330 |
| Molecular Formula | C8H7ClN2OS |
| Molecular Weight | 214.68 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 2-amino-6-chloro-5-methyl-1,3-benzothiazol-4-ol |
| SMILES | Cc1c(Cl)cc2sc(N)nc2c1O |
| InChI | InChI=1S/C8H7ClN2OS/c1-3-4(9)2-5-6(7(3)12)11-8(10)13-5/h2,12H,1H3,(H2,10,11) |
| InChIKey | RIOVOZJSZRQYBF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.68 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |