2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid

C8H6N2O3S — CID 84677518

IUPAC2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid
SMILESNc1nc2c(C(=O)O)cc(O)cc2s1
InChIInChI=1S/C8H6N2O3S/c9-8-10-6-4(7(12)13)1-3(11)2-5(6)14-8/h1-2,11H,(H2,9,10)(H,12,13)
InChIKeyIUAVSYVPNCBZMR-UHFFFAOYSA-N
MW210.21 g/mol
LogP1.28
Rot. Bonds1

About 2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid

2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid (PubChem CID 84677518) has the molecular formula C8H6N2O3S and a molecular weight of 210.21 g/mol. Its IUPAC name is 2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid.

Molecular Properties

Compound Name2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid
PubChem CID84677518
Molecular FormulaC8H6N2O3S
Molecular Weight210.21 g/mol
Exact Mass210.01
IUPAC Name2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid
SMILESNc1nc2c(C(=O)O)cc(O)cc2s1
InChIInChI=1S/C8H6N2O3S/c9-8-10-6-4(7(12)13)1-3(11)2-5(6)14-8/h1-2,11H,(H2,9,10)(H,12,13)
InChIKeyIUAVSYVPNCBZMR-UHFFFAOYSA-N
XLogP1.28
TPSA96.44 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.21
LogP ≤ 51.28
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid?
The IUPAC name of 2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid (CID 84677518) is 2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid.
What is the SMILES notation for 2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid?
The canonical SMILES for 2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid is Nc1nc2c(C(=O)O)cc(O)cc2s1.
What is the InChIKey of 2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid?
The InChIKey is IUAVSYVPNCBZMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O3S/c9-8-10-6-4(7(12)13)1-3(11)2-5(6)14-8/h1-2,11H,(H2,9,10)(H,12,13).
What are the key properties of 2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid?
2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid has a molecular weight of 210.21 g/mol, XLogP of 1.28, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid is sourced from PubChem (CID 84677518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).