C8H6N2O3S — CID 84677518
2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid (PubChem CID 84677518) has the molecular formula C8H6N2O3S and a molecular weight of 210.21 g/mol. Its IUPAC name is 2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid.
| Compound Name | 2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 84677518 |
| Molecular Formula | C8H6N2O3S |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 2-amino-6-hydroxy-1,3-benzothiazole-4-carboxylic acid |
| SMILES | Nc1nc2c(C(=O)O)cc(O)cc2s1 |
| InChI | InChI=1S/C8H6N2O3S/c9-8-10-6-4(7(12)13)1-3(11)2-5(6)14-8/h1-2,11H,(H2,9,10)(H,12,13) |
| InChIKey | IUAVSYVPNCBZMR-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |