C12H12N2O3S — CID 154235812
1-(2-amino-6-methoxy-1,3-benzothiazol-4-yl)butane-1,3-dione (PubChem CID 154235812) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 1-(2-amino-6-methoxy-1,3-benzothiazol-4-yl)butane-1,3-dione.
| Compound Name | 1-(2-amino-6-methoxy-1,3-benzothiazol-4-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 154235812 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 1-(2-amino-6-methoxy-1,3-benzothiazol-4-yl)butane-1,3-dione |
| SMILES | COc1cc(C(=O)CC(C)=O)c2nc(N)sc2c1 |
| InChI | InChI=1S/C12H12N2O3S/c1-6(15)3-9(16)8-4-7(17-2)5-10-11(8)14-12(13)18-10/h4-5H,3H2,1-2H3,(H2,13,14) |
| InChIKey | PJXVJZZPLBFIRC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|