C11H10N4O2S — CID 168522593
N-(2-amino-4-methoxy-1,3-benzothiazol-6-yl)-2-cyanoacetamide (PubChem CID 168522593) has the molecular formula C11H10N4O2S and a molecular weight of 262.29 g/mol. Its IUPAC name is N-(2-amino-4-methoxy-1,3-benzothiazol-6-yl)-2-cyanoacetamide.
| Compound Name | N-(2-amino-4-methoxy-1,3-benzothiazol-6-yl)-2-cyanoacetamide |
|---|---|
| PubChem CID | 168522593 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | N-(2-amino-4-methoxy-1,3-benzothiazol-6-yl)-2-cyanoacetamide |
| SMILES | COc1cc(NC(=O)CC#N)cc2sc(N)nc12 |
| InChI | InChI=1S/C11H10N4O2S/c1-17-7-4-6(14-9(16)2-3-12)5-8-10(7)15-11(13)18-8/h4-5H,2H2,1H3,(H2,13,15)(H,14,16) |
| InChIKey | DQQWZVSDNTXTIU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |