C15H11Cl2N3O2S — CID 91680564
N-(2-amino-4-methoxy-1,3-benzothiazol-6-yl)-3,4-dichlorobenzamide (PubChem CID 91680564) has the molecular formula C15H11Cl2N3O2S and a molecular weight of 368.25 g/mol. Its IUPAC name is N-(2-amino-4-methoxy-1,3-benzothiazol-6-yl)-3,4-dichlorobenzamide.
| Compound Name | N-(2-amino-4-methoxy-1,3-benzothiazol-6-yl)-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 91680564 |
| Molecular Formula | C15H11Cl2N3O2S |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | N-(2-amino-4-methoxy-1,3-benzothiazol-6-yl)-3,4-dichlorobenzamide |
| SMILES | COc1cc(NC(=O)c2ccc(Cl)c(Cl)c2)cc2sc(N)nc12 |
| InChI | InChI=1S/C15H11Cl2N3O2S/c1-22-11-5-8(6-12-13(11)20-15(18)23-12)19-14(21)7-2-3-9(16)10(17)4-7/h2-6H,1H3,(H2,18,20)(H,19,21) |
| InChIKey | XSBSIJBNJAYPOH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |