C11H11Cl2N3O2S — CID 134937993
N-(2-amino-5-methoxy-4-methyl-1,3-benzothiazol-6-yl)-2,2-dichloroacetamide (PubChem CID 134937993) has the molecular formula C11H11Cl2N3O2S and a molecular weight of 320.20 g/mol. Its IUPAC name is N-(2-amino-5-methoxy-4-methyl-1,3-benzothiazol-6-yl)-2,2-dichloroacetamide.
| Compound Name | N-(2-amino-5-methoxy-4-methyl-1,3-benzothiazol-6-yl)-2,2-dichloroacetamide |
|---|---|
| PubChem CID | 134937993 |
| Molecular Formula | C11H11Cl2N3O2S |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | N-(2-amino-5-methoxy-4-methyl-1,3-benzothiazol-6-yl)-2,2-dichloroacetamide |
| SMILES | COc1c(NC(=O)C(Cl)Cl)cc2sc(N)nc2c1C |
| InChI | InChI=1S/C11H11Cl2N3O2S/c1-4-7-6(19-11(14)16-7)3-5(8(4)18-2)15-10(17)9(12)13/h3,9H,1-2H3,(H2,14,16)(H,15,17) |
| InChIKey | ZEWMRHWMFXHVEG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|