C10H10N2O2S — CID 174710079
(2-amino-4-methyl-1,3-benzothiazol-6-yl) acetate (PubChem CID 174710079) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is (2-amino-4-methyl-1,3-benzothiazol-6-yl) acetate.
| Compound Name | (2-amino-4-methyl-1,3-benzothiazol-6-yl) acetate |
|---|---|
| PubChem CID | 174710079 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | (2-amino-4-methyl-1,3-benzothiazol-6-yl) acetate |
| SMILES | CC(=O)Oc1cc(C)c2nc(N)sc2c1 |
| InChI | InChI=1S/C10H10N2O2S/c1-5-3-7(14-6(2)13)4-8-9(5)12-10(11)15-8/h3-4H,1-2H3,(H2,11,12) |
| InChIKey | ZZVAWMGMGKMLHB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|