C15H21N3O3S — CID 142751175
2-[(2-amino-4-methyl-1,3-benzothiazol-6-yl)oxy]ethyl N-tert-butylcarbamate (PubChem CID 142751175) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-[(2-amino-4-methyl-1,3-benzothiazol-6-yl)oxy]ethyl N-tert-butylcarbamate.
| Compound Name | 2-[(2-amino-4-methyl-1,3-benzothiazol-6-yl)oxy]ethyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 142751175 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-[(2-amino-4-methyl-1,3-benzothiazol-6-yl)oxy]ethyl N-tert-butylcarbamate |
| SMILES | Cc1cc(OCCOC(=O)NC(C)(C)C)cc2sc(N)nc12 |
| InChI | InChI=1S/C15H21N3O3S/c1-9-7-10(8-11-12(9)17-13(16)22-11)20-5-6-21-14(19)18-15(2,3)4/h7-8H,5-6H2,1-4H3,(H2,16,17)(H,18,19) |
| InChIKey | GKGHWENQRXJWAN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|