C9H5N2O4PS — CID 141044486
2-amino-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazole-6-carboxylic acid (PubChem CID 141044486) has the molecular formula C9H5N2O4PS and a molecular weight of 268.19 g/mol. Its IUPAC name is 2-amino-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-amino-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 141044486 |
| Molecular Formula | C9H5N2O4PS |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 2-amino-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazole-6-carboxylic acid |
| SMILES | Nc1nc2c(OC#P=O)cc(C(=O)O)cc2s1 |
| InChI | InChI=1S/C9H5N2O4PS/c10-9-11-7-5(15-3-16-14)1-4(8(12)13)2-6(7)17-9/h1-2H,(H2,10,11)(H,12,13) |
| InChIKey | VDCWKUDSYZBFNC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|