C11H11N2O2PS — CID 141044475
7-ethyl-6-methyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-2-amine (PubChem CID 141044475) has the molecular formula C11H11N2O2PS and a molecular weight of 266.26 g/mol. Its IUPAC name is 7-ethyl-6-methyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-2-amine.
| Compound Name | 7-ethyl-6-methyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 141044475 |
| Molecular Formula | C11H11N2O2PS |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 7-ethyl-6-methyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-2-amine |
| SMILES | CCc1c(C)cc(OC#P=O)c2nc(N)sc12 |
| InChI | InChI=1S/C11H11N2O2PS/c1-3-7-6(2)4-8(15-5-16-14)9-10(7)17-11(12)13-9/h4H,3H2,1-2H3,(H2,12,13) |
| InChIKey | LDUQMEYXVQVKEP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|