About 7-ethyl-6-methyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-2-amine
7-ethyl-6-methyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-2-amine (PubChem CID 141044475) has the molecular formula C11H11N2O2PS
and a molecular weight of 266.26 g/mol. Its IUPAC name is 7-ethyl-6-methyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | 7-ethyl-6-methyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-2-amine |
| PubChem CID | 141044475 |
| Molecular Formula | C11H11N2O2PS |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 7-ethyl-6-methyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-2-amine |
| SMILES | CCc1c(C)cc(OC#P=O)c2nc(N)sc12 |
| InChI | InChI=1S/C11H11N2O2PS/c1-3-7-6(2)4-8(15-5-16-14)9-10(7)17-11(12)13-9/h4H,3H2,1-2H3,(H2,12,13) |
| InChIKey | LDUQMEYXVQVKEP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 7-ethyl-6-methyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-6-methyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-2-amine?
The IUPAC name of 7-ethyl-6-methyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-2-amine (CID 141044475) is 7-ethyl-6-methyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-2-amine.
What is the SMILES notation for 7-ethyl-6-methyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-2-amine?
The canonical SMILES for 7-ethyl-6-methyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-2-amine is CCc1c(C)cc(OC#P=O)c2nc(N)sc12.
What is the InChIKey of 7-ethyl-6-methyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-2-amine?
The InChIKey is LDUQMEYXVQVKEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N2O2PS/c1-3-7-6(2)4-8(15-5-16-14)9-10(7)17-11(12)13-9/h4H,3H2,1-2H3,(H2,12,13).
What are the key properties of 7-ethyl-6-methyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-2-amine?
7-ethyl-6-methyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-2-amine has a molecular weight of 266.26 g/mol, XLogP of 3.34, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-6-methyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-2-amine is sourced from PubChem (CID 141044475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).