C13H18N2S — CID 170676483
6-ethyl-4-methyl-7-propan-2-yl-1,3-benzothiazol-2-amine (PubChem CID 170676483) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is 6-ethyl-4-methyl-7-propan-2-yl-1,3-benzothiazol-2-amine.
| Compound Name | 6-ethyl-4-methyl-7-propan-2-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 170676483 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 6-ethyl-4-methyl-7-propan-2-yl-1,3-benzothiazol-2-amine |
| SMILES | CCc1cc(C)c2nc(N)sc2c1C(C)C |
| InChI | InChI=1S/C13H18N2S/c1-5-9-6-8(4)11-12(10(9)7(2)3)16-13(14)15-11/h6-7H,5H2,1-4H3,(H2,14,15) |
| InChIKey | HBDCESPYRKBGGJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |