C8H8ClN3S — CID 82508790
5-(aminomethyl)-6-chloro-1,3-benzothiazol-2-amine (PubChem CID 82508790) has the molecular formula C8H8ClN3S and a molecular weight of 213.69 g/mol. Its IUPAC name is 5-(aminomethyl)-6-chloro-1,3-benzothiazol-2-amine.
| Compound Name | 5-(aminomethyl)-6-chloro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82508790 |
| Molecular Formula | C8H8ClN3S |
| Molecular Weight | 213.69 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | 5-(aminomethyl)-6-chloro-1,3-benzothiazol-2-amine |
| SMILES | NCc1cc2nc(N)sc2cc1Cl |
| InChI | InChI=1S/C8H8ClN3S/c9-5-2-7-6(1-4(5)3-10)12-8(11)13-7/h1-2H,3,10H2,(H2,11,12) |
| InChIKey | VLPTXYSJUUTHDB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.69 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |