C11H11N3S — CID 116994176
2-(2-amino-1,3-benzothiazol-6-yl)butanenitrile (PubChem CID 116994176) has the molecular formula C11H11N3S and a molecular weight of 217.30 g/mol. Its IUPAC name is 2-(2-amino-1,3-benzothiazol-6-yl)butanenitrile.
| Compound Name | 2-(2-amino-1,3-benzothiazol-6-yl)butanenitrile |
|---|---|
| PubChem CID | 116994176 |
| Molecular Formula | C11H11N3S |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-(2-amino-1,3-benzothiazol-6-yl)butanenitrile |
| SMILES | CCC(C#N)c1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C11H11N3S/c1-2-7(6-12)8-3-4-9-10(5-8)15-11(13)14-9/h3-5,7H,2H2,1H3,(H2,13,14) |
| InChIKey | RPWNARLUPIZVID-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |