C15H22N2S — CID 143927852
6-octan-4-yl-1,3-benzothiazol-2-amine (PubChem CID 143927852) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 6-octan-4-yl-1,3-benzothiazol-2-amine.
| Compound Name | 6-octan-4-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 143927852 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 6-octan-4-yl-1,3-benzothiazol-2-amine |
| SMILES | CCCCC(CCC)c1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C15H22N2S/c1-3-5-7-11(6-4-2)12-8-9-13-14(10-12)18-15(16)17-13/h8-11H,3-7H2,1-2H3,(H2,16,17) |
| InChIKey | SUOACKCXJXAXCS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |