C15H21NS — CID 170019483
6-octan-4-yl-1,3-benzothiazole (PubChem CID 170019483) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is 6-octan-4-yl-1,3-benzothiazole.
| Compound Name | 6-octan-4-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 170019483 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 6-octan-4-yl-1,3-benzothiazole |
| SMILES | CCCCC(CCC)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C15H21NS/c1-3-5-7-12(6-4-2)13-8-9-14-15(10-13)17-11-16-14/h8-12H,3-7H2,1-2H3 |
| InChIKey | KOKGYLMZEBFSKL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |