C13H15NS — CID 143099494
6-[(Z)-3-methylpent-2-en-2-yl]-1,3-benzothiazole (PubChem CID 143099494) has the molecular formula C13H15NS and a molecular weight of 217.34 g/mol. Its IUPAC name is 6-[(Z)-3-methylpent-2-en-2-yl]-1,3-benzothiazole.
| Compound Name | 6-[(Z)-3-methylpent-2-en-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 143099494 |
| Molecular Formula | C13H15NS |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 6-[(Z)-3-methylpent-2-en-2-yl]-1,3-benzothiazole |
| SMILES | CC/C(C)=C(/C)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C13H15NS/c1-4-9(2)10(3)11-5-6-12-13(7-11)15-8-14-12/h5-8H,4H2,1-3H3/b10-9- |
| InChIKey | STNOIIAJOFERML-KTKRTIGZSA-N |
| XLogP | 4.50 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |