C14H20N2S — CID 134342554
N-(2-methylhexan-2-yl)-1,3-benzothiazol-6-amine (PubChem CID 134342554) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is N-(2-methylhexan-2-yl)-1,3-benzothiazol-6-amine.
| Compound Name | N-(2-methylhexan-2-yl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 134342554 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | N-(2-methylhexan-2-yl)-1,3-benzothiazol-6-amine |
| SMILES | CCCCC(C)(C)Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C14H20N2S/c1-4-5-8-14(2,3)16-11-6-7-12-13(9-11)17-10-15-12/h6-7,9-10,16H,4-5,8H2,1-3H3 |
| InChIKey | JUJSTZNIKGODIY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |