C13H18N2S — CID 107804012
N-(2-methylpentan-3-yl)-1,3-benzothiazol-6-amine (PubChem CID 107804012) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is N-(2-methylpentan-3-yl)-1,3-benzothiazol-6-amine.
| Compound Name | N-(2-methylpentan-3-yl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 107804012 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N-(2-methylpentan-3-yl)-1,3-benzothiazol-6-amine |
| SMILES | CCC(Nc1ccc2ncsc2c1)C(C)C |
| InChI | InChI=1S/C13H18N2S/c1-4-11(9(2)3)15-10-5-6-12-13(7-10)16-8-14-12/h5-9,11,15H,4H2,1-3H3 |
| InChIKey | QFLMCTPUXSTJCL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |