C13H17N3OS — CID 114003189
N-(1,3-benzothiazol-6-yl)-2-(butan-2-ylamino)acetamide (PubChem CID 114003189) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-yl)-2-(butan-2-ylamino)acetamide.
| Compound Name | N-(1,3-benzothiazol-6-yl)-2-(butan-2-ylamino)acetamide |
|---|---|
| PubChem CID | 114003189 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-(1,3-benzothiazol-6-yl)-2-(butan-2-ylamino)acetamide |
| SMILES | CCC(C)NCC(=O)Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C13H17N3OS/c1-3-9(2)14-7-13(17)16-10-4-5-11-12(6-10)18-8-15-11/h4-6,8-9,14H,3,7H2,1-2H3,(H,16,17) |
| InChIKey | BMFJAHKTMRXWFF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |