C17H16N2OS — CID 41085216
N-(1,3-benzothiazol-6-yl)-2-(2,4-dimethylphenyl)acetamide (PubChem CID 41085216) has the molecular formula C17H16N2OS and a molecular weight of 296.40 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-yl)-2-(2,4-dimethylphenyl)acetamide.
| Compound Name | N-(1,3-benzothiazol-6-yl)-2-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 41085216 |
| Molecular Formula | C17H16N2OS |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N-(1,3-benzothiazol-6-yl)-2-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)Nc2ccc3ncsc3c2)c(C)c1 |
| InChI | InChI=1S/C17H16N2OS/c1-11-3-4-13(12(2)7-11)8-17(20)19-14-5-6-15-16(9-14)21-10-18-15/h3-7,9-10H,8H2,1-2H3,(H,19,20) |
| InChIKey | CEXSKVNIRQCXMX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |