C13H18N2S — CID 107803861
N-(2-methylpentyl)-1,3-benzothiazol-6-amine (PubChem CID 107803861) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is N-(2-methylpentyl)-1,3-benzothiazol-6-amine.
| Compound Name | N-(2-methylpentyl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 107803861 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N-(2-methylpentyl)-1,3-benzothiazol-6-amine |
| SMILES | CCCC(C)CNc1ccc2ncsc2c1 |
| InChI | InChI=1S/C13H18N2S/c1-3-4-10(2)8-14-11-5-6-12-13(7-11)16-9-15-12/h5-7,9-10,14H,3-4,8H2,1-2H3 |
| InChIKey | PBCOLRFBWAOMBN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |