C10H12N2O2S — CID 107804909
3-(1,3-benzothiazol-6-ylamino)propane-1,2-diol (PubChem CID 107804909) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-6-ylamino)propane-1,2-diol.
| Compound Name | 3-(1,3-benzothiazol-6-ylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 107804909 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 3-(1,3-benzothiazol-6-ylamino)propane-1,2-diol |
| SMILES | OCC(O)CNc1ccc2ncsc2c1 |
| InChI | InChI=1S/C10H12N2O2S/c13-5-8(14)4-11-7-1-2-9-10(3-7)15-6-12-9/h1-3,6,8,11,13-14H,4-5H2 |
| InChIKey | VVFJXAOZVQEFKT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |