C15H12F2N2OS — CID 107804707
2-(1,3-benzothiazol-6-ylamino)-1-(2,4-difluorophenyl)ethanol (PubChem CID 107804707) has the molecular formula C15H12F2N2OS and a molecular weight of 306.34 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-6-ylamino)-1-(2,4-difluorophenyl)ethanol.
| Compound Name | 2-(1,3-benzothiazol-6-ylamino)-1-(2,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 107804707 |
| Molecular Formula | C15H12F2N2OS |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-(1,3-benzothiazol-6-ylamino)-1-(2,4-difluorophenyl)ethanol |
| SMILES | OC(CNc1ccc2ncsc2c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H12F2N2OS/c16-9-1-3-11(12(17)5-9)14(20)7-18-10-2-4-13-15(6-10)21-8-19-13/h1-6,8,14,18,20H,7H2 |
| InChIKey | NRHOMATUDWDOKL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |