C11H14N2O2S2 — CID 113354920
N-(1-methylsulfonylpropan-2-yl)-1,3-benzothiazol-6-amine (PubChem CID 113354920) has the molecular formula C11H14N2O2S2 and a molecular weight of 270.38 g/mol. Its IUPAC name is N-(1-methylsulfonylpropan-2-yl)-1,3-benzothiazol-6-amine.
| Compound Name | N-(1-methylsulfonylpropan-2-yl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 113354920 |
| Molecular Formula | C11H14N2O2S2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | N-(1-methylsulfonylpropan-2-yl)-1,3-benzothiazol-6-amine |
| SMILES | CC(CS(C)(=O)=O)Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C11H14N2O2S2/c1-8(6-17(2,14)15)13-9-3-4-10-11(5-9)16-7-12-10/h3-5,7-8,13H,6H2,1-2H3 |
| InChIKey | OIEXXJRAROUFRI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |