C11H15N3O2S2 — CID 114142525
N-(1,3-benzothiazol-6-yl)-1-(methylamino)propane-2-sulfonamide (PubChem CID 114142525) has the molecular formula C11H15N3O2S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-yl)-1-(methylamino)propane-2-sulfonamide.
| Compound Name | N-(1,3-benzothiazol-6-yl)-1-(methylamino)propane-2-sulfonamide |
|---|---|
| PubChem CID | 114142525 |
| Molecular Formula | C11H15N3O2S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | N-(1,3-benzothiazol-6-yl)-1-(methylamino)propane-2-sulfonamide |
| SMILES | CNCC(C)S(=O)(=O)Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C11H15N3O2S2/c1-8(6-12-2)18(15,16)14-9-3-4-10-11(5-9)17-7-13-10/h3-5,7-8,12,14H,6H2,1-2H3 |
| InChIKey | JNDBBEIWVHWELP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |